C19H25N7O2S3 — CID 78262534
2-[[1-(3,4-dimethylphenyl)-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-6-yl]sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 78262534) has the molecular formula C19H25N7O2S3 and a molecular weight of 479.66 g/mol. Its IUPAC name is 2-[[1-(3,4-dimethylphenyl)-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-6-yl]sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[[1-(3,4-dimethylphenyl)-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-6-yl]sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 78262534 |
| Molecular Formula | C19H25N7O2S3 |
| Molecular Weight | 479.66 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 2-[[1-(3,4-dimethylphenyl)-4-oxo-3,3a,5,6,7,7a-hexahydro-2H-pyrazolo[3,4-d]pyrimidin-6-yl]sulfanyl]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCSc1nnc(NC(=O)CSC2NC(=O)C3CNN(c4ccc(C)c(C)c4)C3N2)s1 |
| InChI | InChI=1S/C19H25N7O2S3/c1-4-29-19-25-24-18(31-19)21-14(27)9-30-17-22-15-13(16(28)23-17)8-20-26(15)12-6-5-10(2)11(3)7-12/h5-7,13,15,17,20,22H,4,8-9H2,1-3H3,(H,23,28)(H,21,24,27) |
| InChIKey | PHBCQYLUINDGTK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 111.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.66 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|