C17H20FN7O3S3 — CID 73329620
N-[4-amino-2-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-6-oxo-1,3-diazinan-5-yl]-4-fluorobenzamide (PubChem CID 73329620) has the molecular formula C17H20FN7O3S3 and a molecular weight of 485.59 g/mol. Its IUPAC name is N-[4-amino-2-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-6-oxo-1,3-diazinan-5-yl]-4-fluorobenzamide.
| Compound Name | N-[4-amino-2-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-6-oxo-1,3-diazinan-5-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 73329620 |
| Molecular Formula | C17H20FN7O3S3 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | N-[4-amino-2-[2-[(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-2-oxoethyl]sulfanyl-6-oxo-1,3-diazinan-5-yl]-4-fluorobenzamide |
| SMILES | CCSc1nnc(NC(=O)CSC2NC(=O)C(NC(=O)c3ccc(F)cc3)C(N)N2)s1 |
| InChI | InChI=1S/C17H20FN7O3S3/c1-2-29-17-25-24-16(31-17)20-10(26)7-30-15-22-12(19)11(14(28)23-15)21-13(27)8-3-5-9(18)6-4-8/h3-6,11-12,15,22H,2,7,19H2,1H3,(H,21,27)(H,23,28)(H,20,24,26) |
| InChIKey | LFYGSVVWGQWHRQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 151.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|