About 3-azaniumylnonanoate
3-azaniumylnonanoate (PubChem CID 78263534) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is 3-azaniumylnonanoate.
Molecular Properties
| Compound Name | 3-azaniumylnonanoate |
| PubChem CID | 78263534 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 3-azaniumylnonanoate |
| SMILES | CCCCCCC([NH3+])CC(=O)[O-] |
| InChI | InChI=1S/C9H19NO2/c1-2-3-4-5-6-8(10)7-9(11)12/h8H,2-7,10H2,1H3,(H,11,12) |
| InChIKey | JSJXIPXCQNHXJA-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-azaniumylnonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azaniumylnonanoate?
The IUPAC name of 3-azaniumylnonanoate (CID 78263534) is 3-azaniumylnonanoate.
What is the SMILES notation for 3-azaniumylnonanoate?
The canonical SMILES for 3-azaniumylnonanoate is CCCCCCC([NH3+])CC(=O)[O-].
What is the InChIKey of 3-azaniumylnonanoate?
The InChIKey is JSJXIPXCQNHXJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-2-3-4-5-6-8(10)7-9(11)12/h8H,2-7,10H2,1H3,(H,11,12).
What are the key properties of 3-azaniumylnonanoate?
3-azaniumylnonanoate has a molecular weight of 173.26 g/mol, XLogP of -0.29, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azaniumylnonanoate is sourced from PubChem (CID 78263534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).