About henicosan-11-ylazanium
henicosan-11-ylazanium (PubChem CID 22645794) has the molecular formula C21H46N+
and a molecular weight of 312.61 g/mol. Its IUPAC name is henicosan-11-ylazanium.
Molecular Properties
| Compound Name | henicosan-11-ylazanium |
| PubChem CID | 22645794 |
| Molecular Formula | C21H46N+ |
| Molecular Weight | 312.61 g/mol |
| Exact Mass | 312.36 |
| IUPAC Name | henicosan-11-ylazanium |
| SMILES | CCCCCCCCCCC([NH3+])CCCCCCCCCC |
| InChI | InChI=1S/C21H45N/c1-3-5-7-9-11-13-15-17-19-21(22)20-18-16-14-12-10-8-6-4-2/h21H,3-20,22H2,1-2H3/p+1 |
| InChIKey | GYVLVZDSMHALQK-UHFFFAOYSA-O |
| XLogP | 6.66 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.61 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze henicosan-11-ylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of henicosan-11-ylazanium?
The IUPAC name of henicosan-11-ylazanium (CID 22645794) is henicosan-11-ylazanium.
What is the SMILES notation for henicosan-11-ylazanium?
The canonical SMILES for henicosan-11-ylazanium is CCCCCCCCCCC([NH3+])CCCCCCCCCC.
What is the InChIKey of henicosan-11-ylazanium?
The InChIKey is GYVLVZDSMHALQK-UHFFFAOYSA-O. The full InChI is InChI=1S/C21H45N/c1-3-5-7-9-11-13-15-17-19-21(22)20-18-16-14-12-10-8-6-4-2/h21H,3-20,22H2,1-2H3/p+1.
What are the key properties of henicosan-11-ylazanium?
henicosan-11-ylazanium has a molecular weight of 312.61 g/mol, XLogP of 6.66, 18 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for henicosan-11-ylazanium is sourced from PubChem (CID 22645794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).