About [(3R)-nonan-3-yl]azanium
[(3R)-nonan-3-yl]azanium (PubChem CID 140886283) has the molecular formula C9H22N+
and a molecular weight of 144.28 g/mol. Its IUPAC name is [(3R)-nonan-3-yl]azanium.
Molecular Properties
| Compound Name | [(3R)-nonan-3-yl]azanium |
| PubChem CID | 140886283 |
| Molecular Formula | C9H22N+ |
| Molecular Weight | 144.28 g/mol |
| Exact Mass | 144.17 |
| IUPAC Name | [(3R)-nonan-3-yl]azanium |
| SMILES | CCCCCC[C@H]([NH3+])CC |
| InChI | InChI=1S/C9H21N/c1-3-5-6-7-8-9(10)4-2/h9H,3-8,10H2,1-2H3/p+1/t9-/m1/s1 |
| InChIKey | YRJCXPFMFZIXRI-SECBINFHSA-O |
| XLogP | 1.98 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-nonan-3-yl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-nonan-3-yl]azanium?
The IUPAC name of [(3R)-nonan-3-yl]azanium (CID 140886283) is [(3R)-nonan-3-yl]azanium.
What is the SMILES notation for [(3R)-nonan-3-yl]azanium?
The canonical SMILES for [(3R)-nonan-3-yl]azanium is CCCCCC[C@H]([NH3+])CC.
What is the InChIKey of [(3R)-nonan-3-yl]azanium?
The InChIKey is YRJCXPFMFZIXRI-SECBINFHSA-O. The full InChI is InChI=1S/C9H21N/c1-3-5-6-7-8-9(10)4-2/h9H,3-8,10H2,1-2H3/p+1/t9-/m1/s1.
What are the key properties of [(3R)-nonan-3-yl]azanium?
[(3R)-nonan-3-yl]azanium has a molecular weight of 144.28 g/mol, XLogP of 1.98, 6 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-nonan-3-yl]azanium is sourced from PubChem (CID 140886283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).