About decan-3-ylazanium chloride
decan-3-ylazanium chloride (PubChem CID 88625887) has the molecular formula C10H24ClN
and a molecular weight of 193.76 g/mol. Its IUPAC name is decan-3-ylazanium chloride.
Molecular Properties
| Compound Name | decan-3-ylazanium chloride |
| PubChem CID | 88625887 |
| Molecular Formula | C10H24ClN |
| Molecular Weight | 193.76 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | decan-3-ylazanium chloride |
| SMILES | CCCCCCCC([NH3+])CC.[Cl-] |
| InChI | InChI=1S/C10H23N.ClH/c1-3-5-6-7-8-9-10(11)4-2;/h10H,3-9,11H2,1-2H3;1H |
| InChIKey | PKBJENUOSWIYKT-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.76 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decan-3-ylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-3-ylazanium chloride?
The IUPAC name of decan-3-ylazanium chloride (CID 88625887) is decan-3-ylazanium chloride.
What is the SMILES notation for decan-3-ylazanium chloride?
The canonical SMILES for decan-3-ylazanium chloride is CCCCCCCC([NH3+])CC.[Cl-].
What is the InChIKey of decan-3-ylazanium chloride?
The InChIKey is PKBJENUOSWIYKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N.ClH/c1-3-5-6-7-8-9-10(11)4-2;/h10H,3-9,11H2,1-2H3;1H.
What are the key properties of decan-3-ylazanium chloride?
decan-3-ylazanium chloride has a molecular weight of 193.76 g/mol, XLogP of -0.63, 7 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for decan-3-ylazanium chloride is sourced from PubChem (CID 88625887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).