C18H30N5O2+ — CID 78296180
8-[(2-ethylpiperidin-1-yl)methyl]-1,3-dimethyl-7-propyl-5H-purin-7-ium-2,6-dione (PubChem CID 78296180) has the molecular formula C18H30N5O2+ and a molecular weight of 348.47 g/mol. Its IUPAC name is 8-[(2-ethylpiperidin-1-yl)methyl]-1,3-dimethyl-7-propyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 8-[(2-ethylpiperidin-1-yl)methyl]-1,3-dimethyl-7-propyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78296180 |
| Molecular Formula | C18H30N5O2+ |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 8-[(2-ethylpiperidin-1-yl)methyl]-1,3-dimethyl-7-propyl-5H-purin-7-ium-2,6-dione |
| SMILES | CCC[N+]1=C(CN2CCCCC2CC)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C18H30N5O2/c1-5-10-23-14(12-22-11-8-7-9-13(22)6-2)19-16-15(23)17(24)21(4)18(25)20(16)3/h13,15H,5-12H2,1-4H3/q+1 |
| InChIKey | MJGDLMVMEMFPSD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|