C16H27N5O3 — CID 78304624
8-(azepan-1-yl)-7-(2-ethoxyethyl)-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 78304624) has the molecular formula C16H27N5O3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 8-(azepan-1-yl)-7-(2-ethoxyethyl)-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-(azepan-1-yl)-7-(2-ethoxyethyl)-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78304624 |
| Molecular Formula | C16H27N5O3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | 8-(azepan-1-yl)-7-(2-ethoxyethyl)-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | CCOCCN1C(N2CCCCCC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C16H27N5O3/c1-3-24-11-10-21-12-13(19(2)16(23)18-14(12)22)17-15(21)20-8-6-4-5-7-9-20/h12-13H,3-11H2,1-2H3,(H,18,22,23) |
| InChIKey | HCYCDCLDXQKWRN-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|