C27H50NO9P — CID 78319777
(2S)-2-amino-3-[hydroxy-[(2R,3S)-2-[[(Z)-octadec-9-enoyl]oxymethyl]oxan-3-yl]oxyphosphoryl]oxypropanoic acid (PubChem CID 78319777) has the molecular formula C27H50NO9P and a molecular weight of 563.67 g/mol. Its IUPAC name is (2S)-2-amino-3-[hydroxy-[(2R,3S)-2-[[(Z)-octadec-9-enoyl]oxymethyl]oxan-3-yl]oxyphosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[hydroxy-[(2R,3S)-2-[[(Z)-octadec-9-enoyl]oxymethyl]oxan-3-yl]oxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 78319777 |
| Molecular Formula | C27H50NO9P |
| Molecular Weight | 563.67 g/mol |
| Exact Mass | 563.32 |
| IUPAC Name | (2S)-2-amino-3-[hydroxy-[(2R,3S)-2-[[(Z)-octadec-9-enoyl]oxymethyl]oxan-3-yl]oxyphosphoryl]oxypropanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H]1OCCC[C@@H]1OP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C27H50NO9P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-26(29)35-22-25-24(18-17-20-34-25)37-38(32,33)36-21-23(28)27(30)31/h9-10,23-25H,2-8,11-22,28H2,1H3,(H,30,31)(H,32,33)/b10-9-/t23-,24-,25+/m0/s1 |
| InChIKey | VWKCFDZBVNFTLU-AUMIFUJISA-N |
| XLogP | 5.66 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.67 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|