C23H22Cl2FN5O3 — CID 78320925
4-[5-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-4-methoxy-3-pyridinyl]piperazin-2-one (PubChem CID 78320925) has the molecular formula C23H22Cl2FN5O3 and a molecular weight of 506.37 g/mol. Its IUPAC name is 4-[5-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-4-methoxy-3-pyridinyl]piperazin-2-one.
| Compound Name | 4-[5-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-4-methoxy-3-pyridinyl]piperazin-2-one |
|---|---|
| PubChem CID | 78320925 |
| Molecular Formula | C23H22Cl2FN5O3 |
| Molecular Weight | 506.37 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 4-[5-[6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]-4-methoxy-3-pyridinyl]piperazin-2-one |
| SMILES | COc1c(-c2cnc(N)c(O[C@H](C)c3c(Cl)ccc(F)c3Cl)c2)cncc1N1CCNC(=O)C1 |
| InChI | InChI=1S/C23H22Cl2FN5O3/c1-12(20-15(24)3-4-16(26)21(20)25)34-18-7-13(8-30-23(18)27)14-9-28-10-17(22(14)33-2)31-6-5-29-19(32)11-31/h3-4,7-10,12H,5-6,11H2,1-2H3,(H2,27,30)(H,29,32)/t12-/m1/s1 |
| InChIKey | LKPTUNABVXYZBB-GFCCVEGCSA-N |
| XLogP | 4.26 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|