C35H45N3O12 — CID 78324847
(2R)-2-[[4-[(E)-2-[3,5-bis[[(1S)-1-carboxy-3-methylbutyl]carbamoyloxy]phenyl]ethenyl]phenoxy]carbonylamino]-4-methylpentanoic acid (PubChem CID 78324847) has the molecular formula C35H45N3O12 and a molecular weight of 699.75 g/mol. Its IUPAC name is (2R)-2-[[4-[(E)-2-[3,5-bis[[(1S)-1-carboxy-3-methylbutyl]carbamoyloxy]phenyl]ethenyl]phenoxy]carbonylamino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[4-[(E)-2-[3,5-bis[[(1S)-1-carboxy-3-methylbutyl]carbamoyloxy]phenyl]ethenyl]phenoxy]carbonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 78324847 |
| Molecular Formula | C35H45N3O12 |
| Molecular Weight | 699.75 g/mol |
| Exact Mass | 699.30 |
| IUPAC Name | (2R)-2-[[4-[(E)-2-[3,5-bis[[(1S)-1-carboxy-3-methylbutyl]carbamoyloxy]phenyl]ethenyl]phenoxy]carbonylamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)Oc1cc(/C=C/c2ccc(OC(=O)N[C@H](CC(C)C)C(=O)O)cc2)cc(OC(=O)N[C@@H](CC(C)C)C(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C35H45N3O12/c1-19(2)13-27(30(39)40)36-33(45)48-24-11-9-22(10-12-24)7-8-23-16-25(49-34(46)37-28(31(41)42)14-20(3)4)18-26(17-23)50-35(47)38-29(32(43)44)15-21(5)6/h7-12,16-21,27-29H,13-15H2,1-6H3,(H,36,45)(H,37,46)(H,38,47)(H,39,40)(H,41,42)(H,43,44)/b8-7+/t27-,28+,29+/m1/s1 |
| InChIKey | BUPSGOFZSAOJHN-ACIPQXMUSA-N |
| XLogP | 5.62 |
| TPSA | 226.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.75 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|