C16H14N2O2 — CID 78326275
3-(2,4-dimethylphenyl)-4aH-quinazoline-2,4-dione (PubChem CID 78326275) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-4aH-quinazoline-2,4-dione.
| Compound Name | 3-(2,4-dimethylphenyl)-4aH-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 78326275 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-4aH-quinazoline-2,4-dione |
| SMILES | Cc1ccc(N2C(=O)N=C3C=CC=CC3C2=O)c(C)c1 |
| InChI | InChI=1S/C16H14N2O2/c1-10-7-8-14(11(2)9-10)18-15(19)12-5-3-4-6-13(12)17-16(18)20/h3-9,12H,1-2H3 |
| InChIKey | IVGBHNKJSJKJDJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |