C33H25ClN4OS — CID 78336726
3-[(5-benzhydryl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-6-chloro-4-phenyl-4aH-quinolin-2-one (PubChem CID 78336726) has the molecular formula C33H25ClN4OS and a molecular weight of 561.11 g/mol. Its IUPAC name is 3-[(5-benzhydryl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-6-chloro-4-phenyl-4aH-quinolin-2-one.
| Compound Name | 3-[(5-benzhydryl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-6-chloro-4-phenyl-4aH-quinolin-2-one |
|---|---|
| PubChem CID | 78336726 |
| Molecular Formula | C33H25ClN4OS |
| Molecular Weight | 561.11 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | 3-[(5-benzhydryl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-6-chloro-4-phenyl-4aH-quinolin-2-one |
| SMILES | C=CCn1c(SC2=C(c3ccccc3)C3C=C(Cl)C=CC3=NC2=O)nnc1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H25ClN4OS/c1-2-20-38-31(28(22-12-6-3-7-13-22)23-14-8-4-9-15-23)36-37-33(38)40-30-29(24-16-10-5-11-17-24)26-21-25(34)18-19-27(26)35-32(30)39/h2-19,21,26,28H,1,20H2 |
| InChIKey | PGOOSAQZJBTBQB-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 60.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.11 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|