C18H19N7O2S — CID 78371565
3-[(4-nitrophenyl)methylsulfanyl]-5-(5-phenylpyrazolidin-3-yl)-1,2,4-triazol-4-amine (PubChem CID 78371565) has the molecular formula C18H19N7O2S and a molecular weight of 397.46 g/mol. Its IUPAC name is 3-[(4-nitrophenyl)methylsulfanyl]-5-(5-phenylpyrazolidin-3-yl)-1,2,4-triazol-4-amine.
| Compound Name | 3-[(4-nitrophenyl)methylsulfanyl]-5-(5-phenylpyrazolidin-3-yl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 78371565 |
| Molecular Formula | C18H19N7O2S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 3-[(4-nitrophenyl)methylsulfanyl]-5-(5-phenylpyrazolidin-3-yl)-1,2,4-triazol-4-amine |
| SMILES | Nn1c(SCc2ccc([N+](=O)[O-])cc2)nnc1C1CC(c2ccccc2)NN1 |
| InChI | InChI=1S/C18H19N7O2S/c19-24-17(16-10-15(20-21-16)13-4-2-1-3-5-13)22-23-18(24)28-11-12-6-8-14(9-7-12)25(26)27/h1-9,15-16,20-21H,10-11,19H2 |
| InChIKey | PSJMXGGEOOZQKS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|