C20H27N5O5 — CID 78379437
ethyl 2-[9-(4-methoxyphenyl)-1-methyl-2,4-dioxo-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidin-3-yl]acetate (PubChem CID 78379437) has the molecular formula C20H27N5O5 and a molecular weight of 417.47 g/mol. Its IUPAC name is ethyl 2-[9-(4-methoxyphenyl)-1-methyl-2,4-dioxo-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidin-3-yl]acetate.
| Compound Name | ethyl 2-[9-(4-methoxyphenyl)-1-methyl-2,4-dioxo-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidin-3-yl]acetate |
|---|---|
| PubChem CID | 78379437 |
| Molecular Formula | C20H27N5O5 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | ethyl 2-[9-(4-methoxyphenyl)-1-methyl-2,4-dioxo-6,7,8,9a,10,10a-hexahydro-4aH-purino[7,8-a]pyrimidin-3-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C2C(NC3N(c4ccc(OC)cc4)CCCN23)N(C)C1=O |
| InChI | InChI=1S/C20H27N5O5/c1-4-30-15(26)12-25-18(27)16-17(22(2)20(25)28)21-19-23(10-5-11-24(16)19)13-6-8-14(29-3)9-7-13/h6-9,16-17,19,21H,4-5,10-12H2,1-3H3 |
| InChIKey | AORRGQTYOGTQRH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|