C11H14N3O5S+ — CID 78383708
N-(furan-2-ylmethyl)-1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-sulfonamide (PubChem CID 78383708) has the molecular formula C11H14N3O5S+ and a molecular weight of 300.32 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-sulfonamide.
| Compound Name | N-(furan-2-ylmethyl)-1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-sulfonamide |
|---|---|
| PubChem CID | 78383708 |
| Molecular Formula | C11H14N3O5S+ |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | N-(furan-2-ylmethyl)-1,3-dimethyl-2,4-dioxo-5H-pyrimidin-1-ium-5-sulfonamide |
| SMILES | CN1C(=O)C(S(=O)(=O)NCc2ccco2)C=[N+](C)C1=O |
| InChI | InChI=1S/C11H14N3O5S/c1-13-7-9(10(15)14(2)11(13)16)20(17,18)12-6-8-4-3-5-19-8/h3-5,7,9,12H,6H2,1-2H3/q+1 |
| InChIKey | ABCACSPQCXQUBB-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|