C17H17N3O4S2 — CID 78452126
3-(4-methylphenyl)-5-thiophen-2-ylsulfonyl-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 78452126) has the molecular formula C17H17N3O4S2 and a molecular weight of 391.47 g/mol. Its IUPAC name is 3-(4-methylphenyl)-5-thiophen-2-ylsulfonyl-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-(4-methylphenyl)-5-thiophen-2-ylsulfonyl-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 78452126 |
| Molecular Formula | C17H17N3O4S2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 3-(4-methylphenyl)-5-thiophen-2-ylsulfonyl-4a,6,7,7a-tetrahydro-1H-pyrrolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | Cc1ccc(N2C(=O)NC3CCN(S(=O)(=O)c4cccs4)C3C2=O)cc1 |
| InChI | InChI=1S/C17H17N3O4S2/c1-11-4-6-12(7-5-11)20-16(21)15-13(18-17(20)22)8-9-19(15)26(23,24)14-3-2-10-25-14/h2-7,10,13,15H,8-9H2,1H3,(H,18,22) |
| InChIKey | DUJTURXKMQZRGL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |