C22H27N3O5 — CID 78460839
1-(2-morpholin-4-yl-2-oxoethyl)-3-phenyl-4a,5a,6,7,8,9,9a,9b-octahydro-[1]benzofuro[3,2-d]pyrimidine-2,4-dione (PubChem CID 78460839) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is 1-(2-morpholin-4-yl-2-oxoethyl)-3-phenyl-4a,5a,6,7,8,9,9a,9b-octahydro-[1]benzofuro[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 1-(2-morpholin-4-yl-2-oxoethyl)-3-phenyl-4a,5a,6,7,8,9,9a,9b-octahydro-[1]benzofuro[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 78460839 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 1-(2-morpholin-4-yl-2-oxoethyl)-3-phenyl-4a,5a,6,7,8,9,9a,9b-octahydro-[1]benzofuro[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=C(CN1C(=O)N(c2ccccc2)C(=O)C2OC3CCCCC3C21)N1CCOCC1 |
| InChI | InChI=1S/C22H27N3O5/c26-18(23-10-12-29-13-11-23)14-24-19-16-8-4-5-9-17(16)30-20(19)21(27)25(22(24)28)15-6-2-1-3-7-15/h1-3,6-7,16-17,19-20H,4-5,8-14H2 |
| InChIKey | RCISUJRJQWTGAU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |