C16H16F3N4O2S+ — CID 78469015
1,3,9-trimethyl-8-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-5H-purin-9-ium-2,6-dione (PubChem CID 78469015) has the molecular formula C16H16F3N4O2S+ and a molecular weight of 385.39 g/mol. Its IUPAC name is 1,3,9-trimethyl-8-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-5H-purin-9-ium-2,6-dione.
| Compound Name | 1,3,9-trimethyl-8-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-5H-purin-9-ium-2,6-dione |
|---|---|
| PubChem CID | 78469015 |
| Molecular Formula | C16H16F3N4O2S+ |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 1,3,9-trimethyl-8-[[4-(trifluoromethyl)phenyl]methylsulfanyl]-5H-purin-9-ium-2,6-dione |
| SMILES | CN1C(=O)C2N=C(SCc3ccc(C(F)(F)F)cc3)[N+](C)=C2N(C)C1=O |
| InChI | InChI=1S/C16H16F3N4O2S/c1-21-12-11(13(24)23(3)15(25)22(12)2)20-14(21)26-8-9-4-6-10(7-5-9)16(17,18)19/h4-7,11H,8H2,1-3H3/q+1 |
| InChIKey | GOLIDCXVFPXDJF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|