About 2-hydroxy-2-methyl-N'-(2-methylphenyl)propanehydrazide
2-hydroxy-2-methyl-N'-(2-methylphenyl)propanehydrazide (PubChem CID 785622) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-N'-(2-methylphenyl)propanehydrazide.
Molecular Properties
| Compound Name | 2-hydroxy-2-methyl-N'-(2-methylphenyl)propanehydrazide |
| PubChem CID | 785622 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-hydroxy-2-methyl-N'-(2-methylphenyl)propanehydrazide |
| SMILES | Cc1ccccc1NNC(=O)C(C)(C)O |
| InChI | InChI=1S/C11H16N2O2/c1-8-6-4-5-7-9(8)12-13-10(14)11(2,3)15/h4-7,12,15H,1-3H3,(H,13,14) |
| InChIKey | NGTSMSNPEUQDIX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-methyl-N'-(2-methylphenyl)propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-methyl-N'-(2-methylphenyl)propanehydrazide?
The IUPAC name of 2-hydroxy-2-methyl-N'-(2-methylphenyl)propanehydrazide (CID 785622) is 2-hydroxy-2-methyl-N'-(2-methylphenyl)propanehydrazide.
What is the SMILES notation for 2-hydroxy-2-methyl-N'-(2-methylphenyl)propanehydrazide?
The canonical SMILES for 2-hydroxy-2-methyl-N'-(2-methylphenyl)propanehydrazide is Cc1ccccc1NNC(=O)C(C)(C)O.
What is the InChIKey of 2-hydroxy-2-methyl-N'-(2-methylphenyl)propanehydrazide?
The InChIKey is NGTSMSNPEUQDIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-8-6-4-5-7-9(8)12-13-10(14)11(2,3)15/h4-7,12,15H,1-3H3,(H,13,14).
What are the key properties of 2-hydroxy-2-methyl-N'-(2-methylphenyl)propanehydrazide?
2-hydroxy-2-methyl-N'-(2-methylphenyl)propanehydrazide has a molecular weight of 208.26 g/mol, XLogP of 1.21, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-methyl-N'-(2-methylphenyl)propanehydrazide is sourced from PubChem (CID 785622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).