C28H22N4O7S3 — CID 78579549
N-(4-sulfamoylphenyl)-2-[2-[(8S)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide (PubChem CID 78579549) has the molecular formula C28H22N4O7S3 and a molecular weight of 622.71 g/mol. Its IUPAC name is N-(4-sulfamoylphenyl)-2-[2-[(8S)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide.
| Compound Name | N-(4-sulfamoylphenyl)-2-[2-[(8S)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 78579549 |
| Molecular Formula | C28H22N4O7S3 |
| Molecular Weight | 622.71 g/mol |
| Exact Mass | 622.07 |
| IUPAC Name | N-(4-sulfamoylphenyl)-2-[2-[(8S)-5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COc2ccccc2[C@H]2c3sc(=O)[nH]c3SC3C(=O)N(c4ccccc4)C(=O)C32)cc1 |
| InChI | InChI=1S/C28H22N4O7S3/c29-42(37,38)17-12-10-15(11-13-17)30-20(33)14-39-19-9-5-4-8-18(19)21-22-24(40-25-23(21)41-28(36)31-25)27(35)32(26(22)34)16-6-2-1-3-7-16/h1-13,21-22,24H,14H2,(H,30,33)(H,31,36)(H2,29,37,38)/t21-,22?,24?/m1/s1 |
| InChIKey | CGUAQGRNWZPQAY-ZLHNRXBCSA-N |
| XLogP | 2.90 |
| TPSA | 168.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.71 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|