C24H33ClNO3+ — CID 7872368
[(2R)-3-[(1S)-1-(4-chlorophenyl)ethoxy]-2-hydroxypropyl]-cyclohexyl-[(2-hydroxyphenyl)methyl]azanium (PubChem CID 7872368) has the molecular formula C24H33ClNO3+ and a molecular weight of 418.99 g/mol. Its IUPAC name is [(2R)-3-[(1S)-1-(4-chlorophenyl)ethoxy]-2-hydroxypropyl]-cyclohexyl-[(2-hydroxyphenyl)methyl]azanium.
| Compound Name | [(2R)-3-[(1S)-1-(4-chlorophenyl)ethoxy]-2-hydroxypropyl]-cyclohexyl-[(2-hydroxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7872368 |
| Molecular Formula | C24H33ClNO3+ |
| Molecular Weight | 418.99 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | [(2R)-3-[(1S)-1-(4-chlorophenyl)ethoxy]-2-hydroxypropyl]-cyclohexyl-[(2-hydroxyphenyl)methyl]azanium |
| SMILES | C[C@H](OC[C@H](O)C[NH+](Cc1ccccc1O)C1CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H32ClNO3/c1-18(19-11-13-21(25)14-12-19)29-17-23(27)16-26(22-8-3-2-4-9-22)15-20-7-5-6-10-24(20)28/h5-7,10-14,18,22-23,27-28H,2-4,8-9,15-17H2,1H3/p+1/t18-,23+/m0/s1 |
| InChIKey | PCQAVHYILBMYFS-FDDCHVKYSA-O |
| XLogP | 3.90 |
| TPSA | 54.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.99 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|