C22H32N4O2S — CID 78770485
2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide (PubChem CID 78770485) has the molecular formula C22H32N4O2S and a molecular weight of 416.59 g/mol. Its IUPAC name is 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide.
| Compound Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide |
|---|---|
| PubChem CID | 78770485 |
| Molecular Formula | C22H32N4O2S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide |
| SMILES | CC(SCC(=O)NCC1(N2CCOCC2)CCCCC1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H32N4O2S/c1-17(21-24-18-7-3-4-8-19(18)25-21)29-15-20(27)23-16-22(9-5-2-6-10-22)26-11-13-28-14-12-26/h3-4,7-8,17H,2,5-6,9-16H2,1H3,(H,23,27)(H,24,25) |
| InChIKey | NBDWLJFGGVXRMI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |