C16H22N4O4 — CID 78770611
(3-methylcyclohexyl) 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetate (PubChem CID 78770611) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is (3-methylcyclohexyl) 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetate.
| Compound Name | (3-methylcyclohexyl) 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetate |
|---|---|
| PubChem CID | 78770611 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (3-methylcyclohexyl) 2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetate |
| SMILES | CC1CCCC(OC(=O)Cn2c(=O)c3c(ncn3C)n(C)c2=O)C1 |
| InChI | InChI=1S/C16H22N4O4/c1-10-5-4-6-11(7-10)24-12(21)8-20-15(22)13-14(17-9-18(13)2)19(3)16(20)23/h9-11H,4-8H2,1-3H3 |
| InChIKey | IEZVRMMXGPMXDC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |