C18H26N4O4 — CID 78804990
N-(cyclohexylmethyl)-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide (PubChem CID 78804990) has the molecular formula C18H26N4O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide.
| Compound Name | N-(cyclohexylmethyl)-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide |
|---|---|
| PubChem CID | 78804990 |
| Molecular Formula | C18H26N4O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | N-(cyclohexylmethyl)-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CC(=O)NCC2CCCCC2)c1=O |
| InChI | InChI=1S/C18H26N4O4/c1-3-10-20-16(24)21(11-4-2)18(26)22(17(20)25)13-15(23)19-12-14-8-6-5-7-9-14/h3-4,14H,1-2,5-13H2,(H,19,23) |
| InChIKey | DFHNEEALTHPGHN-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|