C21H21N5OS2 — CID 78806668
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]acetamide (PubChem CID 78806668) has the molecular formula C21H21N5OS2 and a molecular weight of 423.57 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 78806668 |
| Molecular Formula | C21H21N5OS2 |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]acetamide |
| SMILES | CN(C)c1ccc(Cn2nccc2NC(=O)CSc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C21H21N5OS2/c1-25(2)16-9-7-15(8-10-16)13-26-19(11-12-22-26)24-20(27)14-28-21-23-17-5-3-4-6-18(17)29-21/h3-12H,13-14H2,1-2H3,(H,24,27) |
| InChIKey | GRWVFXWGODXFPU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|