C23H26N6OS — CID 78806733
2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]acetamide (PubChem CID 78806733) has the molecular formula C23H26N6OS and a molecular weight of 434.57 g/mol. Its IUPAC name is 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]acetamide.
| Compound Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 78806733 |
| Molecular Formula | C23H26N6OS |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 2-[1-(1H-benzimidazol-2-yl)ethylsulfanyl]-N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]acetamide |
| SMILES | CC(SCC(=O)Nc1ccnn1Cc1ccc(N(C)C)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H26N6OS/c1-16(23-25-19-6-4-5-7-20(19)26-23)31-15-22(30)27-21-12-13-24-29(21)14-17-8-10-18(11-9-17)28(2)3/h4-13,16H,14-15H2,1-3H3,(H,25,26)(H,27,30) |
| InChIKey | DWCWLYOOMLQDNK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|