C18H21ClFNO3 — CID 7880713
[2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate (PubChem CID 7880713) has the molecular formula C18H21ClFNO3 and a molecular weight of 353.82 g/mol. Its IUPAC name is [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7880713 |
| Molecular Formula | C18H21ClFNO3 |
| Molecular Weight | 353.82 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | [2-[[(1S,2R)-2-methylcyclohexyl]amino]-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)COC(=O)/C=C/c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H21ClFNO3/c1-12-4-2-3-5-16(12)21-17(22)11-24-18(23)9-7-13-6-8-15(20)14(19)10-13/h6-10,12,16H,2-5,11H2,1H3,(H,21,22)/b9-7+/t12-,16+/m1/s1 |
| InChIKey | BFVMXWYCPPHWRV-GGMIUFRYSA-N |
| XLogP | 3.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.82 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|