C17H19ClN2OS — CID 78811425
(E)-3-(3-chloro-1-benzothiophen-2-yl)-1-(4-methyl-1,4-diazepan-1-yl)prop-2-en-1-one (PubChem CID 78811425) has the molecular formula C17H19ClN2OS and a molecular weight of 334.87 g/mol. Its IUPAC name is (E)-3-(3-chloro-1-benzothiophen-2-yl)-1-(4-methyl-1,4-diazepan-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-chloro-1-benzothiophen-2-yl)-1-(4-methyl-1,4-diazepan-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 78811425 |
| Molecular Formula | C17H19ClN2OS |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | (E)-3-(3-chloro-1-benzothiophen-2-yl)-1-(4-methyl-1,4-diazepan-1-yl)prop-2-en-1-one |
| SMILES | CN1CCCN(C(=O)/C=C/c2sc3ccccc3c2Cl)CC1 |
| InChI | InChI=1S/C17H19ClN2OS/c1-19-9-4-10-20(12-11-19)16(21)8-7-15-17(18)13-5-2-3-6-14(13)22-15/h2-3,5-8H,4,9-12H2,1H3/b8-7+ |
| InChIKey | APQODPHDMZGGHJ-BQYQJAHWSA-N |
| XLogP | 3.73 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|