C21H22N4O5 — CID 78815481
2-[[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole (PubChem CID 78815481) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-[[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 78815481 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-[[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]methyl]-5-(4-nitrophenyl)-1,3,4-oxadiazole |
| SMILES | COc1ccc(OC)c(C2CCCN2Cc2nnc(-c3ccc([N+](=O)[O-])cc3)o2)c1 |
| InChI | InChI=1S/C21H22N4O5/c1-28-16-9-10-19(29-2)17(12-16)18-4-3-11-24(18)13-20-22-23-21(30-20)14-5-7-15(8-6-14)25(26)27/h5-10,12,18H,3-4,11,13H2,1-2H3 |
| InChIKey | OUKWCQOQHZCVKA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 103.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|