C14H10Cl2N2O — CID 78836902
4,5-dichloro-N-(3-phenylprop-2-ynyl)-1H-pyrrole-2-carboxamide (PubChem CID 78836902) has the molecular formula C14H10Cl2N2O and a molecular weight of 293.15 g/mol. Its IUPAC name is 4,5-dichloro-N-(3-phenylprop-2-ynyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4,5-dichloro-N-(3-phenylprop-2-ynyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 78836902 |
| Molecular Formula | C14H10Cl2N2O |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 4,5-dichloro-N-(3-phenylprop-2-ynyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCC#Cc1ccccc1)c1cc(Cl)c(Cl)[nH]1 |
| InChI | InChI=1S/C14H10Cl2N2O/c15-11-9-12(18-13(11)16)14(19)17-8-4-7-10-5-2-1-3-6-10/h1-3,5-6,9,18H,8H2,(H,17,19) |
| InChIKey | WYBPOBWOFBENGZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|