C23H21N5O2S — CID 78846347
N-methyl-5-(phenylcarbamoylamino)-N-[(1-phenylpyrazol-4-yl)methyl]thiophene-2-carboxamide (PubChem CID 78846347) has the molecular formula C23H21N5O2S and a molecular weight of 431.52 g/mol. Its IUPAC name is N-methyl-5-(phenylcarbamoylamino)-N-[(1-phenylpyrazol-4-yl)methyl]thiophene-2-carboxamide.
| Compound Name | N-methyl-5-(phenylcarbamoylamino)-N-[(1-phenylpyrazol-4-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78846347 |
| Molecular Formula | C23H21N5O2S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-methyl-5-(phenylcarbamoylamino)-N-[(1-phenylpyrazol-4-yl)methyl]thiophene-2-carboxamide |
| SMILES | CN(Cc1cnn(-c2ccccc2)c1)C(=O)c1ccc(NC(=O)Nc2ccccc2)s1 |
| InChI | InChI=1S/C23H21N5O2S/c1-27(15-17-14-24-28(16-17)19-10-6-3-7-11-19)22(29)20-12-13-21(31-20)26-23(30)25-18-8-4-2-5-9-18/h2-14,16H,15H2,1H3,(H2,25,26,30) |
| InChIKey | KFMTYKMFSPYMAO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |