C20H21N3O2S — CID 97111991
N-methyl-5-[(2S)-oxolan-2-yl]-N-[(1-phenylpyrazol-4-yl)methyl]thiophene-2-carboxamide (PubChem CID 97111991) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-methyl-5-[(2S)-oxolan-2-yl]-N-[(1-phenylpyrazol-4-yl)methyl]thiophene-2-carboxamide.
| Compound Name | N-methyl-5-[(2S)-oxolan-2-yl]-N-[(1-phenylpyrazol-4-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 97111991 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-methyl-5-[(2S)-oxolan-2-yl]-N-[(1-phenylpyrazol-4-yl)methyl]thiophene-2-carboxamide |
| SMILES | CN(Cc1cnn(-c2ccccc2)c1)C(=O)c1ccc([C@@H]2CCCO2)s1 |
| InChI | InChI=1S/C20H21N3O2S/c1-22(13-15-12-21-23(14-15)16-6-3-2-4-7-16)20(24)19-10-9-18(26-19)17-8-5-11-25-17/h2-4,6-7,9-10,12,14,17H,5,8,11,13H2,1H3/t17-/m0/s1 |
| InChIKey | DMPDLEAARFQPJO-KRWDZBQOSA-N |
| XLogP | 4.06 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |