About 4-oxopentyl 2-(4-fluorophenoxy)-2-methylpropanoate
4-oxopentyl 2-(4-fluorophenoxy)-2-methylpropanoate (PubChem CID 78846639) has the molecular formula C15H19FO4
and a molecular weight of 282.31 g/mol. Its IUPAC name is 4-oxopentyl 2-(4-fluorophenoxy)-2-methylpropanoate.
Molecular Properties
| Compound Name | 4-oxopentyl 2-(4-fluorophenoxy)-2-methylpropanoate |
| PubChem CID | 78846639 |
| Molecular Formula | C15H19FO4 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 4-oxopentyl 2-(4-fluorophenoxy)-2-methylpropanoate |
| SMILES | CC(=O)CCCOC(=O)C(C)(C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C15H19FO4/c1-11(17)5-4-10-19-14(18)15(2,3)20-13-8-6-12(16)7-9-13/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | KFYYQDMPSMMLEM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-oxopentyl 2-(4-fluorophenoxy)-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxopentyl 2-(4-fluorophenoxy)-2-methylpropanoate?
The IUPAC name of 4-oxopentyl 2-(4-fluorophenoxy)-2-methylpropanoate (CID 78846639) is 4-oxopentyl 2-(4-fluorophenoxy)-2-methylpropanoate.
What is the SMILES notation for 4-oxopentyl 2-(4-fluorophenoxy)-2-methylpropanoate?
The canonical SMILES for 4-oxopentyl 2-(4-fluorophenoxy)-2-methylpropanoate is CC(=O)CCCOC(=O)C(C)(C)Oc1ccc(F)cc1.
What is the InChIKey of 4-oxopentyl 2-(4-fluorophenoxy)-2-methylpropanoate?
The InChIKey is KFYYQDMPSMMLEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FO4/c1-11(17)5-4-10-19-14(18)15(2,3)20-13-8-6-12(16)7-9-13/h6-9H,4-5,10H2,1-3H3.
What are the key properties of 4-oxopentyl 2-(4-fluorophenoxy)-2-methylpropanoate?
4-oxopentyl 2-(4-fluorophenoxy)-2-methylpropanoate has a molecular weight of 282.31 g/mol, XLogP of 2.90, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxopentyl 2-(4-fluorophenoxy)-2-methylpropanoate is sourced from PubChem (CID 78846639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).