C20H20N4O4S — CID 78850471
N-[3-(1,3,4-oxadiazol-2-yl)phenyl]-2-piperidin-1-ylsulfonylbenzamide (PubChem CID 78850471) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is N-[3-(1,3,4-oxadiazol-2-yl)phenyl]-2-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[3-(1,3,4-oxadiazol-2-yl)phenyl]-2-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 78850471 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N-[3-(1,3,4-oxadiazol-2-yl)phenyl]-2-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1cccc(-c2nnco2)c1)c1ccccc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C20H20N4O4S/c25-19(22-16-8-6-7-15(13-16)20-23-21-14-28-20)17-9-2-3-10-18(17)29(26,27)24-11-4-1-5-12-24/h2-3,6-10,13-14H,1,4-5,11-12H2,(H,22,25) |
| InChIKey | STROTNWMZLKJIL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |