C21H24N2O5S — CID 55727718
N-(2,2-dimethyl-1,3-benzodioxol-5-yl)-2-piperidin-1-ylsulfonylbenzamide (PubChem CID 55727718) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is N-(2,2-dimethyl-1,3-benzodioxol-5-yl)-2-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(2,2-dimethyl-1,3-benzodioxol-5-yl)-2-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55727718 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | N-(2,2-dimethyl-1,3-benzodioxol-5-yl)-2-piperidin-1-ylsulfonylbenzamide |
| SMILES | CC1(C)Oc2ccc(NC(=O)c3ccccc3S(=O)(=O)N3CCCCC3)cc2O1 |
| InChI | InChI=1S/C21H24N2O5S/c1-21(2)27-17-11-10-15(14-18(17)28-21)22-20(24)16-8-4-5-9-19(16)29(25,26)23-12-6-3-7-13-23/h4-5,8-11,14H,3,6-7,12-13H2,1-2H3,(H,22,24) |
| InChIKey | ZLDHHZSNPPBFSV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |