C13H27NO4S — CID 78852670
2-(2-methoxyethylsulfonyl)-N,N-bis(2-methylpropyl)acetamide (PubChem CID 78852670) has the molecular formula C13H27NO4S and a molecular weight of 293.43 g/mol. Its IUPAC name is 2-(2-methoxyethylsulfonyl)-N,N-bis(2-methylpropyl)acetamide.
| Compound Name | 2-(2-methoxyethylsulfonyl)-N,N-bis(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 78852670 |
| Molecular Formula | C13H27NO4S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-(2-methoxyethylsulfonyl)-N,N-bis(2-methylpropyl)acetamide |
| SMILES | COCCS(=O)(=O)CC(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C13H27NO4S/c1-11(2)8-14(9-12(3)4)13(15)10-19(16,17)7-6-18-5/h11-12H,6-10H2,1-5H3 |
| InChIKey | DJYOBANSTAVOQS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |