C20H27ClN2O3 — CID 78852776
ethyl 3-[1-(2-chlorophenyl)ethyl-cyclopropylcarbamoyl]piperidine-1-carboxylate (PubChem CID 78852776) has the molecular formula C20H27ClN2O3 and a molecular weight of 378.90 g/mol. Its IUPAC name is ethyl 3-[1-(2-chlorophenyl)ethyl-cyclopropylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | ethyl 3-[1-(2-chlorophenyl)ethyl-cyclopropylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 78852776 |
| Molecular Formula | C20H27ClN2O3 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | ethyl 3-[1-(2-chlorophenyl)ethyl-cyclopropylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC(C(=O)N(C2CC2)C(C)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C20H27ClN2O3/c1-3-26-20(25)22-12-6-7-15(13-22)19(24)23(16-10-11-16)14(2)17-8-4-5-9-18(17)21/h4-5,8-9,14-16H,3,6-7,10-13H2,1-2H3 |
| InChIKey | FMJJPRWBHYQNCY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |