C23H22N4O2S — CID 78853392
N-[(4-cyanophenyl)methyl]-5-(phenylcarbamoylamino)-N-propan-2-ylthiophene-2-carboxamide (PubChem CID 78853392) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-5-(phenylcarbamoylamino)-N-propan-2-ylthiophene-2-carboxamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-5-(phenylcarbamoylamino)-N-propan-2-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 78853392 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-5-(phenylcarbamoylamino)-N-propan-2-ylthiophene-2-carboxamide |
| SMILES | CC(C)N(Cc1ccc(C#N)cc1)C(=O)c1ccc(NC(=O)Nc2ccccc2)s1 |
| InChI | InChI=1S/C23H22N4O2S/c1-16(2)27(15-18-10-8-17(14-24)9-11-18)22(28)20-12-13-21(30-20)26-23(29)25-19-6-4-3-5-7-19/h3-13,16H,15H2,1-2H3,(H2,25,26,29) |
| InChIKey | DYGFOIZDUAHKJR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |