C18H23FN2O3 — CID 78867246
3-[2-(3-fluorophenoxy)ethyl]-6,10-dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 78867246) has the molecular formula C18H23FN2O3 and a molecular weight of 334.39 g/mol. Its IUPAC name is 3-[2-(3-fluorophenoxy)ethyl]-6,10-dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[2-(3-fluorophenoxy)ethyl]-6,10-dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 78867246 |
| Molecular Formula | C18H23FN2O3 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 3-[2-(3-fluorophenoxy)ethyl]-6,10-dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CCCC(C)C12NC(=O)N(CCOc1cccc(F)c1)C2=O |
| InChI | InChI=1S/C18H23FN2O3/c1-12-5-3-6-13(2)18(12)16(22)21(17(23)20-18)9-10-24-15-8-4-7-14(19)11-15/h4,7-8,11-13H,3,5-6,9-10H2,1-2H3,(H,20,23) |
| InChIKey | LOVKREYDTRYYSN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|