C18H20N4O3S — CID 78869864
2-[[3-(cyclohexanecarbonylamino)benzoyl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 78869864) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is 2-[[3-(cyclohexanecarbonylamino)benzoyl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[[3-(cyclohexanecarbonylamino)benzoyl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 78869864 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-[[3-(cyclohexanecarbonylamino)benzoyl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1cnc(NC(=O)c2cccc(NC(=O)C3CCCCC3)c2)s1 |
| InChI | InChI=1S/C18H20N4O3S/c19-15(23)14-10-20-18(26-14)22-17(25)12-7-4-8-13(9-12)21-16(24)11-5-2-1-3-6-11/h4,7-11H,1-3,5-6H2,(H2,19,23)(H,21,24)(H,20,22,25) |
| InChIKey | XCEJLPBUIUJNRW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |