C18H26N4O4S — CID 78869966
N-[2-(benzenesulfonamido)ethyl]-4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)butanamide (PubChem CID 78869966) has the molecular formula C18H26N4O4S and a molecular weight of 394.50 g/mol. Its IUPAC name is N-[2-(benzenesulfonamido)ethyl]-4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)butanamide.
| Compound Name | N-[2-(benzenesulfonamido)ethyl]-4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)butanamide |
|---|---|
| PubChem CID | 78869966 |
| Molecular Formula | C18H26N4O4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-[2-(benzenesulfonamido)ethyl]-4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)butanamide |
| SMILES | CC(C)(C)c1noc(CCCC(=O)NCCNS(=O)(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C18H26N4O4S/c1-18(2,3)17-21-16(26-22-17)11-7-10-15(23)19-12-13-20-27(24,25)14-8-5-4-6-9-14/h4-6,8-9,20H,7,10-13H2,1-3H3,(H,19,23) |
| InChIKey | NZZWQTWTUWENHJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|