C20H29N3O4 — CID 75399285
4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[2-[(4-methoxyphenyl)methoxy]ethyl]butanamide (PubChem CID 75399285) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[2-[(4-methoxyphenyl)methoxy]ethyl]butanamide.
| Compound Name | 4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[2-[(4-methoxyphenyl)methoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 75399285 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 4-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-[2-[(4-methoxyphenyl)methoxy]ethyl]butanamide |
| SMILES | COc1ccc(COCCNC(=O)CCCc2nc(C(C)(C)C)no2)cc1 |
| InChI | InChI=1S/C20H29N3O4/c1-20(2,3)19-22-18(27-23-19)7-5-6-17(24)21-12-13-26-14-15-8-10-16(25-4)11-9-15/h8-11H,5-7,12-14H2,1-4H3,(H,21,24) |
| InChIKey | IGFCFKVUSFMDHT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|