C18H26F2N2O2 — CID 78876057
3-[4-(difluoromethoxy)phenyl]-N-[2-(2-methylpiperidin-1-yl)ethyl]propanamide (PubChem CID 78876057) has the molecular formula C18H26F2N2O2 and a molecular weight of 340.41 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-N-[2-(2-methylpiperidin-1-yl)ethyl]propanamide.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-N-[2-(2-methylpiperidin-1-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 78876057 |
| Molecular Formula | C18H26F2N2O2 |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-N-[2-(2-methylpiperidin-1-yl)ethyl]propanamide |
| SMILES | CC1CCCCN1CCNC(=O)CCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H26F2N2O2/c1-14-4-2-3-12-22(14)13-11-21-17(23)10-7-15-5-8-16(9-6-15)24-18(19)20/h5-6,8-9,14,18H,2-4,7,10-13H2,1H3,(H,21,23) |
| InChIKey | HSVDACXBGUAKRP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |