C21H21N5O2 — CID 78876546
N-[4-(3-oxopiperazin-1-yl)phenyl]-2-(4-pyrazol-1-ylphenyl)acetamide (PubChem CID 78876546) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[4-(3-oxopiperazin-1-yl)phenyl]-2-(4-pyrazol-1-ylphenyl)acetamide.
| Compound Name | N-[4-(3-oxopiperazin-1-yl)phenyl]-2-(4-pyrazol-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 78876546 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-[4-(3-oxopiperazin-1-yl)phenyl]-2-(4-pyrazol-1-ylphenyl)acetamide |
| SMILES | O=C1CN(c2ccc(NC(=O)Cc3ccc(-n4cccn4)cc3)cc2)CCN1 |
| InChI | InChI=1S/C21H21N5O2/c27-20(14-16-2-6-19(7-3-16)26-12-1-10-23-26)24-17-4-8-18(9-5-17)25-13-11-22-21(28)15-25/h1-10,12H,11,13-15H2,(H,22,28)(H,24,27) |
| InChIKey | HRRFSKNWGUOTEN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|