C20H34N4O3S — CID 78877647
N-(6-methylheptan-2-yl)-2-[4-(4-sulfamoylphenyl)piperazin-1-yl]acetamide (PubChem CID 78877647) has the molecular formula C20H34N4O3S and a molecular weight of 410.58 g/mol. Its IUPAC name is N-(6-methylheptan-2-yl)-2-[4-(4-sulfamoylphenyl)piperazin-1-yl]acetamide.
| Compound Name | N-(6-methylheptan-2-yl)-2-[4-(4-sulfamoylphenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 78877647 |
| Molecular Formula | C20H34N4O3S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | N-(6-methylheptan-2-yl)-2-[4-(4-sulfamoylphenyl)piperazin-1-yl]acetamide |
| SMILES | CC(C)CCCC(C)NC(=O)CN1CCN(c2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C20H34N4O3S/c1-16(2)5-4-6-17(3)22-20(25)15-23-11-13-24(14-12-23)18-7-9-19(10-8-18)28(21,26)27/h7-10,16-17H,4-6,11-15H2,1-3H3,(H,22,25)(H2,21,26,27) |
| InChIKey | ISFCOYXBQWXZHN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |