C18H28N4O3S — CID 78877654
4-[4-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]benzenesulfonamide (PubChem CID 78877654) has the molecular formula C18H28N4O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is 4-[4-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]benzenesulfonamide.
| Compound Name | 4-[4-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 78877654 |
| Molecular Formula | C18H28N4O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 4-[4-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]benzenesulfonamide |
| SMILES | CC1CCCN(C(=O)CN2CCN(c3ccc(S(N)(=O)=O)cc3)CC2)C1 |
| InChI | InChI=1S/C18H28N4O3S/c1-15-3-2-8-22(13-15)18(23)14-20-9-11-21(12-10-20)16-4-6-17(7-5-16)26(19,24)25/h4-7,15H,2-3,8-14H2,1H3,(H2,19,24,25) |
| InChIKey | SQLCJUGNVFDANZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |