C18H22BrN3O3S — CID 78887055
5-bromo-N-[4-[2-(3-cyclopentylpropylamino)-2-oxoethyl]-1,3-thiazol-2-yl]furan-2-carboxamide (PubChem CID 78887055) has the molecular formula C18H22BrN3O3S and a molecular weight of 440.36 g/mol. Its IUPAC name is 5-bromo-N-[4-[2-(3-cyclopentylpropylamino)-2-oxoethyl]-1,3-thiazol-2-yl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[4-[2-(3-cyclopentylpropylamino)-2-oxoethyl]-1,3-thiazol-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 78887055 |
| Molecular Formula | C18H22BrN3O3S |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 5-bromo-N-[4-[2-(3-cyclopentylpropylamino)-2-oxoethyl]-1,3-thiazol-2-yl]furan-2-carboxamide |
| SMILES | O=C(Cc1csc(NC(=O)c2ccc(Br)o2)n1)NCCCC1CCCC1 |
| InChI | InChI=1S/C18H22BrN3O3S/c19-15-8-7-14(25-15)17(24)22-18-21-13(11-26-18)10-16(23)20-9-3-6-12-4-1-2-5-12/h7-8,11-12H,1-6,9-10H2,(H,20,23)(H,21,22,24) |
| InChIKey | OSKSXHNSGRMUNY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|