C15H12BrN5O4S — CID 78887642
5-bromo-N-[4-[2-oxo-2-[2-(1H-pyrrole-2-carbonyl)hydrazinyl]ethyl]-1,3-thiazol-2-yl]furan-2-carboxamide (PubChem CID 78887642) has the molecular formula C15H12BrN5O4S and a molecular weight of 438.26 g/mol. Its IUPAC name is 5-bromo-N-[4-[2-oxo-2-[2-(1H-pyrrole-2-carbonyl)hydrazinyl]ethyl]-1,3-thiazol-2-yl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[4-[2-oxo-2-[2-(1H-pyrrole-2-carbonyl)hydrazinyl]ethyl]-1,3-thiazol-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 78887642 |
| Molecular Formula | C15H12BrN5O4S |
| Molecular Weight | 438.26 g/mol |
| Exact Mass | 436.98 |
| IUPAC Name | 5-bromo-N-[4-[2-oxo-2-[2-(1H-pyrrole-2-carbonyl)hydrazinyl]ethyl]-1,3-thiazol-2-yl]furan-2-carboxamide |
| SMILES | O=C(Cc1csc(NC(=O)c2ccc(Br)o2)n1)NNC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C15H12BrN5O4S/c16-11-4-3-10(25-11)14(24)19-15-18-8(7-26-15)6-12(22)20-21-13(23)9-2-1-5-17-9/h1-5,7,17H,6H2,(H,20,22)(H,21,23)(H,18,19,24) |
| InChIKey | DFNAJWZKLTZHIV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 129.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|