C23H25N5O2S — CID 78890544
5-(phenylcarbamoylamino)-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]thiophene-2-carboxamide (PubChem CID 78890544) has the molecular formula C23H25N5O2S and a molecular weight of 435.55 g/mol. Its IUPAC name is 5-(phenylcarbamoylamino)-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]thiophene-2-carboxamide.
| Compound Name | 5-(phenylcarbamoylamino)-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 78890544 |
| Molecular Formula | C23H25N5O2S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 5-(phenylcarbamoylamino)-N-[(2-piperidin-1-yl-4-pyridinyl)methyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(C(=O)NCc2ccnc(N3CCCCC3)c2)s1 |
| InChI | InChI=1S/C23H25N5O2S/c29-22(25-16-17-11-12-24-20(15-17)28-13-5-2-6-14-28)19-9-10-21(31-19)27-23(30)26-18-7-3-1-4-8-18/h1,3-4,7-12,15H,2,5-6,13-14,16H2,(H,25,29)(H2,26,27,30) |
| InChIKey | LBZWMEYJQIRGGZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |